A5559412
1-Methyl-1H-pyrazole-4-carboxaldehyde , ≥96% , 25016-11-9
CAS NO.：25016-11-9
Empirical Formula: C5H6N2O
Molecular Weight: 110.11
MDL number: MFCD00460465
EINECS: 627-692-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB119.20 | In Stock |
|
| 25g | RMB359.20 | In Stock |
|
| 100g | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 29-34 °C |
| Boiling point: | 60-62°C/0.08mm |
| Density | 1.14±0.1 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | powder to lump to clear liquid |
| pka | 0.17±0.10(Predicted) |
| color | White or Colorless to Yellow to Orange |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C5H6N2O/c1-7-3-5(4-8)2-6-7/h2-4H,1H3 |
| InChIKey | MYFZXSOYJVWTBL-UHFFFAOYSA-N |
| SMILES | N1(C)C=C(C=O)C=N1 |
Description and Uses
1-Methyl-1H-pyrazole-4-carbaldehyde is a pharmaceutical intermediate used in the synthesis of the CHK1 inhibitor MK-8776.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H317-H318-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41-43 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29331990 |
