A5541812
1-(2-Methoxyphenyl)piperazine , ≥98.0%(GC) , 35386-24-4
CAS NO.：35386-24-4
Empirical Formula: C11H16N2O
Molecular Weight: 192.26
MDL number: MFCD00005958
EINECS: 252-537-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB88.00 | In Stock |
|
| 100G | RMB220.80 | In Stock |
|
| 500g | RMB993.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 35-40 °C (lit.) |
| Boiling point: | 130-133 °C/0.1 mmHg (lit.) |
| Density | 1.095 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Liquid After Melting |
| pka | 8.98±0.10(Predicted) |
| color | Clear colorless to yellow |
| Water Solubility | Soluble in chloroform, ethyl acetate, and methanol. Insoluble in water |
| Sensitive | Air Sensitive |
| BRN | 167888 |
| InChI | InChI=1S/C11H16N2O/c1-14-11-5-3-2-4-10(11)13-8-6-12-7-9-13/h2-5,12H,6-9H2,1H3 |
| InChIKey | VNZLQLYBRIOLFZ-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=CC=C2OC)CCNCC1 |
| LogP | 1.67 |
Description and Uses
1-(2-Methoxyphenyl)piperazine can be used:
- To functionalize pyrazolylvinyl ketones via Aza-Michael addition reaction.
- To prepare cyclic amine substituted Tr?ger′s base derivatives.
- To prepare functionalized bis(mercaptoimidazolyl)borates by reacting with the activated ester, [(1-methyl-2-mercaptoimidazol-5-yl)carbonyl]succinimide.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C,Xi |
| Risk Statements | 34-36/37/38 |
| Safety Statements | 26-36/37/39-45-28A-36 |
| RIDADR | UN 3263 8/PG 3 |
| WGK Germany | 3 |
| F | 3-10 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | Ⅲ |
| HS Code | 29349990 |
