A5540212
Methyl Nonafluorobutyl Ether , ≥98.0%(GC) , 163702-07-6
Synonym(s):
HFE-7100;Methoxynonafluorobutane;Methoxyperfluorobutane;Nonafluorobutyl methyl ether;Nonafluoromethoxybutane
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25g | RMB92.80 | In Stock |
|
| 100G | RMB302.40 | In Stock |
|
| 500G | RMB1380.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -135 °C (lit.) |
| Boiling point: | 60 °C (lit.) |
| Density | 1.529 g/mL at 20 °C
1.52 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | -18℃ |
| storage temp. | 2-8°C |
| BRN | 8768491 |
| InChI | InChI=1S/C5H3F9O/c1-15-5(13,14)3(8,9)2(6,7)4(10,11)12/h1H3 |
| InChIKey | OKIYQFLILPKULA-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)C(F)(F)C(F)(F)C(F)(F)OC |
| LogP | 4.670 (est) |
Description and Uses
Methoxyperfluorobutane can be used as a solvent:
- In the synthesis of various aryl fluoride derivatives via electrophilic fluorination of aryl and heteroaryl Grignard reagents.
- In grafting of fluorinated diblock copolymers onto silica particles.
