A5523512
Methocarbamol , ≥98% , 532-03-6
Synonym(s):
Guaiacol glyceryl ether carbamate;Methocarbamol
CAS NO.：532-03-6
Empirical Formula: C11H15NO5
Molecular Weight: 241.24
MDL number: MFCD00057662
EINECS: 208-524-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB84.80 | In Stock |
|
| 25G | RMB234.40 | In Stock |
|
| 100G | RMB778.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-97°C |
| Boiling point: | 384.01°C (rough estimate) |
| Density | 1.2611 (rough estimate) |
| refractive index | 1.5080 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 13.08±0.20(Predicted) |
| color | White to Off-White |
| Merck | 14,5980 |
| InChI | InChI=1S/C11H15NO5/c1-15-9-4-2-3-5-10(9)16-6-8(13)7-17-11(12)14/h2-5,8,13H,6-7H2,1H3,(H2,12,14) |
| InChIKey | GNXFOGHNGIVQEH-UHFFFAOYSA-N |
| SMILES | C(OC(=O)N)C(O)COC1=CC=CC=C1OC |
| CAS DataBase Reference | 532-03-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Methocarbamol(532-03-6) |
| EPA Substance Registry System | Methocarbamol (532-03-6) |
Description and Uses
Methocarbamol suppresses multisynaptic pathways in the spinal cord. It is used for relieving spasms and skeletal muscle pain as well as for treating tetanus. Synonyms of this drug are delaxin, forbaxin, robamol, robaxin, and tresortil.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H317-H334 |
| Precautionary statements | P280-P301+P312+P330-P302+P352 |
| Hazard Codes | Xn |
| Risk Statements | 22-42/43 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | TY8750000 |
| HS Code | 29222990 |
| Hazardous Substances Data | 532-03-6(Hazardous Substances Data) |
