A5510412
2-Methyl-4-nitrophenol , >98.0% , 99-53-6
CAS NO.：99-53-6
Empirical Formula: C7H7NO3
Molecular Weight: 153.14
MDL number: MFCD01734013
EINECS: 202-763-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB43.20 | In Stock |
|
| 25G | RMB158.40 | In Stock |
|
| 100G | RMB591.20 | In Stock |
|
| 500g | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93-98 °C(lit.) |
| Boiling point: | 266.03°C (rough estimate) |
| Density | 1.2744 (estimate) |
| refractive index | 1.5744 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 7.43±0.22(Predicted) |
| form | Solid |
| color | Off-White |
| InChI | InChI=1S/C7H7NO3/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4,9H,1H3 |
| InChIKey | KDQPMQNHVQVVMR-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C([N+]([O-])=O)C=C1C |
Description and Uses
2-Methyl-4-nitrophenol is suitable as a target compound in the study on measurement of methylnitrophenol concentrations and stable isotope ratios in the atmospheric particulate matter and as an internal standard in the determination of monoaromatic nitro compounds in atmospheric aerosols using high performance liquid chromatography electrospray tandem mass spectrometry (HPLC/ESI-MS/MS) method.
It may be used as starting material in the synthesis of 2-bromo-4-nitro-6-methylphenol.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2446 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | GP2700000 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2908990000 |
| Toxicity | LD50 oral(mouse) 390 mg/kg |
