A5500712
5-Methoxyisatin , 98% , 39755-95-8
CAS NO.：39755-95-8
Empirical Formula: C9H7NO3
Molecular Weight: 177.16
MDL number: MFCD00169023
EINECS: 670-372-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB40.00 | In Stock |
|
| 5G | RMB112.80 | In Stock |
|
| 25G | RMB423.20 | In Stock |
|
| 100G | RMB1343.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 201-203°C |
| Density | 1.346±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 9.73±0.20(Predicted) |
| color | Orange to Amber to Dark red |
| Water Solubility | Soluble in cold water. |
| InChI | InChI=1S/C9H7NO3/c1-13-5-2-3-7-6(4-5)8(11)9(12)10-7/h2-4H,1H3,(H,10,11,12) |
| InChIKey | DMHGXMPXHPOXBF-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(OC)C=C2)C(=O)C1=O |
Description and Uses
5-Methoxyisatin is used for Pharmaceutical intermediates, a raw material used in chemical synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RTECS | NL7938000 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
