A5486712
4-Methoxy-N-methylbenzylamine , 97% , 702-24-9
CAS NO.：702-24-9
Empirical Formula: C9H13NO
Molecular Weight: 151.21
MDL number: MFCD04115407
EINECS: 200-002-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB59.20 | In Stock |
|
| 5G | RMB206.40 | In Stock |
|
| 25g | RMB765.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 238 °C |
| Boiling point: | 88 °C |
| Density | 1.008 g/mL at 25 °C |
| refractive index | n20/D1.529 |
| Flash point: | 109℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | 10.14±0.10(Predicted) |
| color | Clear Beige |
| InChI | InChI=1S/C9H13NO/c1-10-7-8-3-5-9(11-2)6-4-8/h3-6,10H,7H2,1-2H3 |
| InChIKey | AIJFPNKGGAPZFJ-UHFFFAOYSA-N |
| SMILES | C1(CNC)=CC=C(OC)C=C1 |
| CAS DataBase Reference | 702-24-9(CAS DataBase Reference) |
Description and Uses
N-(4-Methoxybenzyl)-N-methylamine is used in the synthetic preparation of many types of compounds, including the synthesis of trifluoromethyl-sulfonimidamides from sulfinamides as well as the preparation of piperazinylquinazoline amine compounds as toll-like receptor 9 signaling antagonists for treatment of immune disorders.
Safety
| Symbol(GHS) |   GHS07,GHS05 |
| Signal word | Warning |
| Hazard statements | H314-H318-H302 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | C,Xn |
| Risk Statements | 36/37/38-34-22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 2735 8/PG III |
| WGK Germany | 1 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2921490090 |
