A5480012
2-Methoxybenzonitrile , 98% , 6609-56-9
CAS NO.：6609-56-9
Empirical Formula: C8H7NO
Molecular Weight: 133.15
MDL number: MFCD00001783
EINECS: 229-559-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB26.40 | In Stock |
|
| 25G | RMB85.60 | In Stock |
|
| 100G | RMB324.00 | In Stock |
|
| 500g | RMB1272.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 24.5°C |
| Boiling point: | 135 °C12 mm Hg(lit.) |
| Density | 1.093 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Slightly soluble in water |
| form | Liquid |
| color | Clear colorless to pale yellow |
| BRN | 2207134 |
| InChI | InChI=1S/C8H7NO/c1-10-8-5-3-2-4-7(8)6-9/h2-5H,1H3 |
| InChIKey | FSTPMFASNVISBU-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC=C1OC |
Description and Uses
2-Methoxybenzonitrile was used in the synthesis of 5-(4′-methyl [1,1′-biphenyl]-2-yl)-1H-tetrazole.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
