PRODUCT Properties
| Melting point: | 252-253 C |
| Boiling point: | 506.0±60.0 °C(Predicted) |
| Density | 1.68±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| solubility | Soluble in DMSO. |
| pka | 13.37±0.70(Predicted) |
| form | Powder |
| color | White to Off-white |
| PH | 4.2 |
| λmax | 281 (pH 1)；273 (EtOH) |
| InChI | InChI=1S/C10H15N3O5/c1-17-8-7(15)5(4-14)18-9(8)13-3-2-6(11)12-10(13)16/h2-3,5,7-9,14-15H,4H2,1H3,(H2,11,12,16)/t5-,7-,8-,9-/m1/s1 |
| InChIKey | RFCQJGFZUQFYRF-ZOQUXTDFSA-N |
| SMILES | OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)[C@H](OC)[C@@H]1O |
Description and Uses
2'-O-Methylcytidine is a nucleoside with a hydroxyl group on the 2' carbon, making it an effective viral replication inhibitor. 2'-O-Methylcytidine is also metabolized by nucleotide salvage pathways and may be able to bind to the response element on DNA, which could inhibit protein synthesis in cancer cells. It is an inhibitor of hepatitis C virus (HCV) non-structural protein 5B (NS5B; IC50 = 3.8 μM). It inhibits HCV replication in a replicon assay (IC50 = 21.2 μM).
Cytidine analog.
Safety
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29349990 |
