A5440012
4-Morpholinoaniline , ≥98% , 2524-67-6
CAS NO.：2524-67-6
Empirical Formula: C10H14N2O
Molecular Weight: 178.23
MDL number: MFCD00006169
EINECS: 219-760-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB72.80 | In Stock |
|
| 25G | RMB213.60 | In Stock |
|
| 100G | RMB783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-135 °C(lit.) |
| Boiling point: | 310.47°C (rough estimate) |
| Density | 1.0777 (rough estimate) |
| refractive index | 1.5250 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in chloroform, ethyl acetate. |
| form | Crystalline Powder |
| pka | 6.72±0.40(Predicted) |
| color | Purple to brown |
| BRN | 150957 |
| InChI | InChI=1S/C10H14N2O/c11-9-1-3-10(4-2-9)12-5-7-13-8-6-12/h1-4H,5-8,11H2 |
| InChIKey | PHNDZBFLOPIMSM-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(N2CCOCC2)C=C1 |
Description and Uses
4-Morpholinoaniline is a morpholine derivative used in the preparation of central nervous system (CNS) active agents. 4-Morpholinoaniline is also one of the primary aromatic amines used in the colour developing process in photographs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-36/37/39-22 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HazardClass | 6.1 |
| HS Code | 29349990 |
