A5435912
Methyl 3,5-dimethoxybenzoate , 99% , 2150-37-0
CAS NO.：2150-37-0
Empirical Formula: C10H12O4
Molecular Weight: 196.2
MDL number: MFCD00008432
EINECS: 218-423-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB29.60 | In Stock |
|
| 10G | RMB56.00 | In Stock |
|
| 25G | RMB95.20 | In Stock |
|
| 50G | RMB164.00 | In Stock |
|
| 100G | RMB271.20 | In Stock |
|
| 250G | RMB608.80 | In Stock |
|
| 500g | RMB991.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42-43 °C (lit.) |
| Boiling point: | 298 °C (lit.) |
| Density | 1.2166 (rough estimate) |
| refractive index | 1.5430 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Methanol |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| BRN | 2693126 |
| InChI | InChI=1S/C10H12O4/c1-12-8-4-7(10(11)14-3)5-9(6-8)13-2/h4-6H,1-3H3 |
| InChIKey | YXUIOVUOFQKWDM-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC(OC)=CC(OC)=C1 |
| LogP | 1.850 (est) |
Description and Uses
Methyl 3,5-dimethoxybenzoate is a benzoate analogue mainly used in the field of organic synthesis. It can be used to prepare compounds such as 5,7-Dimethoxyindan-1-one and 3,5-Dimethoxyphenylacetonitrile.
Methyl 3,5-dimethoxybenzoate was used as starting reagent in the synthesis of 5,7-dimethoxy-4-methylphthalide, a key intermediate in the synthesis of mycophenolic acid and its analogues.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36/37-26 |
| WGK Germany | 3 |
| HS Code | 29189900 |
