A5428912
5-Methylnicotinic acid , 97% , 3222-49-9
Synonym(s):
5-Methylnicotinic acid
CAS NO.：3222-49-9
Empirical Formula: C7H7NO2
Molecular Weight: 137.14
MDL number: MFCD00829036
EINECS: 608-720-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB30.40 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB111.20 | In Stock |
|
| 100G | RMB359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210-212°C |
| Boiling point: | 303.9±22.0 °C(Predicted) |
| Density | 1.230±0.06 g/cm3(Predicted) |
| vapor pressure | 0.328Pa at 25℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Sparingly soluble (0.083 g/L at 25°C). |
| form | Solid:particulate/powder |
| pka | 2.27±0.10(Predicted) |
| BRN | 112288 |
| InChI | InChI=1S/C7H7NO2/c1-5-2-6(7(9)10)4-8-3-5/h2-4H,1H3,(H,9,10) |
| InChIKey | DJDHHXDFKSLEQY-UHFFFAOYSA-N |
| SMILES | C1=NC=C(C)C=C1C(O)=O |
| LogP | 1.23 |
Description and Uses
5-Methylnicotinic acid is an important raw material and intermediate used in organic synthesis, pharmaceuticals and agrochemicals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339900 |
