A5361112
3-Methyldiphenylamine , 98% , 1205-64-7
CAS NO.：1205-64-7
Empirical Formula: C13H13N
Molecular Weight: 183.25
MDL number: MFCD00008530
EINECS: 214-885-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 10G | RMB59.20 | In Stock |
|
| 25G | RMB94.40 | In Stock |
|
| 50G | RMB176.00 | In Stock |
|
| 100g | RMB260.00 | In Stock |
|
| 500g | RMB982.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 30 °C |
| Boiling point: | 315 °C/724 mmHg (lit.) |
| Density | 1.066 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 0.97±0.30(Predicted) |
| form | clear liquid |
| color | Colorless to Yellow to Orange |
| InChI | InChI=1S/C13H13N/c1-11-6-5-9-13(10-11)14-12-7-3-2-4-8-12/h2-10,14H,1H3 |
| InChIKey | TWPMMLHBHPYSMT-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=CC=C2)=CC=CC(C)=C1 |
Description and Uses
3-methyldiphenylamine and its derivatives are widely used in the OLED devices as an organic semiconductor. Organic and polymer photovoltaics have the potential to become a flexible low-cost alternative to inorganic semiconductor-based photovoltaics[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29214990 |
