A5345112
4-Methoxycinnamic acid, predominantly trans , 99% , 830-09-1
Synonym(s):
trans-3-(4-Methoxyphenyl)acrylic acid
CAS NO.：830-09-1
Empirical Formula: C10H10O3
Molecular Weight: 178.18
MDL number: MFCD00004398
EINECS: 212-594-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB35.20 | In Stock |
|
| 100G | RMB126.40 | In Stock |
|
| 250g | RMB167.20 | In Stock |
|
| 500G | RMB424.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 173.5 °C(lit.) |
| Boiling point: | 250.41°C (rough estimate) |
| Density | 1.1479 (rough estimate) |
| refractive index | 1.5088 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in dimethyl sulfoxide and methanol. |
| form | Fine Crystalline Powder |
| pka | pK1:4.539 (25°C) |
| color | White |
| InChI | InChI=1S/C10H10O3/c1-13-9-5-2-8(3-6-9)4-7-10(11)12/h2-7H,1H3,(H,11,12) |
| InChIKey | AFDXODALSZRGIH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C=CC1=CC=C(OC)C=C1 |
| LogP | 2.680 |
Description and Uses
4-Methoxycinnamic acid(p-MCA) exerted antihyperglycemic/hypoglycemic effect by stimulating insulin secretion from pancreas and could be developed into a new potential for therapeutic agent used in type 2 diabetic patients.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| RTECS | UD3391300 |
| F | 8 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HS Code | 29173990 |
