A5249212
Lawesson reagent , 97% , 19172-47-5
Synonym(s):
2,4-Bis-(4-methoxyphenyl)-1,3-dithia-2,4-diphosphetane 2,4-disulfide;2,4-Bis(4-methoxyphenyl)-2,4-dithioxo-1,3,2,4-dithiadiphosphetane;4-Methoxyphenylthiophosphoric cyclic di(thioanhydride);LR
CAS NO.：19172-47-5
Empirical Formula: C14H14O2P2S4
Molecular Weight: 404.47
MDL number: MFCD00005171
EINECS: 242-855-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB47.20 | In Stock |
|
| 100G | RMB113.60 | In Stock |
|
| 250G | RMB237.60 | In Stock |
|
| 500G | RMB428.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 228-230 °C(lit.) |
| Boiling point: | 525.8±60.0 °C(Predicted) |
| Density | 1.48±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly) |
| form | Powder |
| color | White to almost white |
| Water Solubility | Decomposition |
| Sensitive | Moisture Sensitive |
| Merck | 14,5391 |
| BRN | 1024888 |
| InChI | InChI=1S/C14H14O2P2S4/c1-15-11-3-7-13(8-4-11)17(19)21-18(20,22-17)14-9-5-12(16-2)6-10-14/h3-10H,1-2H3 |
| InChIKey | CFHGBZLNZZVTAY-UHFFFAOYSA-N |
| SMILES | S1P(=S)(C2=CC=C(OC)C=C2)SP1(=S)C1=CC=C(OC)C=C1 |
| CAS DataBase Reference | 19172-47-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3,2,4-Dithiadiphosphetane, 2,4-bis(4-methoxyphenyl)-, 2,4-disulfide (19172-47-5) |
Description and Uses
Thiation reagent.
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Danger |
| Hazard statements | H261 |
| Precautionary statements | P231+P232-P422 |
| Hazard Codes | Xn-F,Xi,Xn,F |
| Risk Statements | 20/21/22-15/29-37 |
| Safety Statements | 8-43-36/37-22-38-7/8 |
| RIDADR | 3278 |
| WGK Germany | 3 |
| F | 13-21 |
| TSCA | Yes |
| HazardClass | 4.3 |
| PackingGroup | III |
| HS Code | 29349990 |
