A5086312
Indazole-3-carboxylic Acid , >98.0%(HPLC) , 4498-67-3
CAS NO.：4498-67-3
Empirical Formula: C8H6N2O2
Molecular Weight: 162.15
MDL number: MFCD00211066
EINECS: 224-794-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB85.52 | In Stock |
|
| 100G | RMB233.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 266-270 °C (dec.) |
| Boiling point: | 443.7±18.0 °C(Predicted) |
| Density | 1.506±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | powder |
| pka | 3.03±0.10(Predicted) |
| color | beige |
| BRN | 6354 |
| InChI | InChI=1S/C8H6N2O2/c11-8(12)7-5-3-1-2-4-6(5)9-10-7/h1-4H,(H,9,10)(H,11,12) |
| InChIKey | BHXVYTQDWMQVBI-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(C(O)=O)=N1 |
Description and Uses
Indazole-3-carboxylic acid may be used in the synthesis of the following:
- N-(8-methyl-azabicyclo[3.2.11]oct-3-yl)-1H-indazole-3-carboxamide
- N-(1- benzyl-4-methylhexahydro-1H-1,4-diazepin-6-yl)-1H-indazole-3-carboxamide
- 1H-indazole-3-carboxamide
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36-36/37/38 |
| Safety Statements | 26-36/37/39-22 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
