A5076012
4-Isothiocyanato-2-(trifluoromethyl)benzonitrile , >98.0%(HPLC) , 143782-23-4
CAS NO.：143782-23-4
Empirical Formula: C9H3F3N2S
Molecular Weight: 228.19
MDL number: MFCD09800709
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB70.40 | In Stock |
|
| 25G | RMB269.60 | In Stock |
|
| 100g | RMB939.20 | In Stock |
|
| 500G | RMB3983.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 39.0 to 43.0 °C |
| Boiling point: | 331℃ |
| Density | 1.31 |
| Flash point: | 154℃ |
| storage temp. | Inert atmosphere, 2-8°C |
| solubility | Chloroform (Sparingly), DMSO (Sparingly), Methanol (Slightly) |
| form | powder to lump |
| color | White to Yellow to Green |
| Stability: | Hygroscopic, Moisture sensitive |
| InChI | InChI=1S/C9H3F3N2S/c10-9(11,12)8-3-7(14-5-15)2-1-6(8)4-13/h1-3H |
| InChIKey | TYXKOMAQTWRDCR-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(N=C=S)C=C1C(F)(F)F |
Description and Uses
4-Cyano-3-trifluoromethylphenylisothiocyanate is an reagent used in the synthesis of thioxoimidazolidinones as potential anti-prostate cancer agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H227 |
| Precautionary statements | P501-P210-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313-P403+P235 |
| HS Code | 2929100090 |
