A5051012
<i>O</i>-Benzyl-<i>N</i>-(<i>tert</i>-butoxycarbonyl)-<small>D</small>-serine , ≥98.0%(HPLC) , 47173-80-8
Synonym(s):
Boc-Ser(Bzl)-OH;N-α-t.-Boc-O-benzyl-D-serine;N-α-t.-Boc-O-benzyl-L-serine;Boc-O-benzyl-D -serine;Boc-O-benzyl-L -serine
CAS NO.：47173-80-8
Empirical Formula: C15H21NO5
Molecular Weight: 295.33
MDL number: MFCD00038248
EINECS: 827-299-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB44.00 | In Stock |
|
| 5G | RMB137.60 | In Stock |
|
| 25G | RMB550.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 58-60 °C(lit.) |
| alpha | -19 º (c=2 80% alcohol) |
| Boiling point: | 437.02°C (rough estimate) |
| Density | 1.1454 (rough estimate) |
| refractive index | -20 ° (C=2, 80% EtOH) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Methanol |
| form | Powder |
| pka | 3.53±0.10(Predicted) |
| color | White |
| BRN | 2665080 |
| InChI | InChI=1S/C15H21NO5/c1-15(2,3)21-14(19)16-12(13(17)18)10-20-9-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,16,19)(H,17,18)/t12-/m1/s1 |
| InChIKey | DMBKPDOAQVGTST-GFCCVEGCSA-N |
| SMILES | C(O)(=O)[C@@H](COCC1=CC=CC=C1)NC(OC(C)(C)C)=O |
Description and Uses
N-BOC-O-Benzyl-D-serine, is an amino acid derivative used in chemical synthesis and peptide chemistry.is used in preparation of substituted naphthyl thiadiazolidinones as protein tyrosine phosphatase degraders for treating cancer and metabolic diseases.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |
