A5001312
1H-Imidazole-4-carboxylic acid , 98% , 1072-84-0
CAS NO.：1072-84-0
Empirical Formula: C4H4N2O2
Molecular Weight: 112.09
MDL number: MFCD00082203
EINECS: 214-017-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB30.40 | In Stock |
|
| 5G | RMB72.00 | In Stock |
|
| 25g | RMB276.80 | In Stock |
|
| 100G | RMB1064.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 294-295 °C (lit.) |
| Boiling point: | 495.0±18.0 °C(Predicted) |
| Density | 1.524±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Aqueous Acid (sparingly) |
| pka | 2.69±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless |
| InChI | InChI=1S/C4H4N2O2/c7-4(8)3-1-5-2-6-3/h1-2H,(H,5,6)(H,7,8) |
| InChIKey | NKWCGTOZTHZDHB-UHFFFAOYSA-N |
| SMILES | C1NC(C(O)=O)=CN=1 |
Description and Uses
4-Imidazolecarboxylic acid (ICA) was used in the synthesis of triphenymethyl-protected 4-imidazole carboxylic acid (trityl-ImCOOH) which is employed to functionalize poly(propylene imine) dendrimers.
It may be used in the following studies:
- In the synthesis of lanthanide sulfate–carboxylates, [Ln(HIMC)(SO4)(H2O)] (Ln = Dy and Eu, HIMC = 4-imidazolecarboxylic acid) by in situ decarboxylation in the presence of Cu(II) ions.
- As an internal standard to obtain calibration curve by plotting the peak area ratios of histamine (HA) and several metabolites isolated from C3H/HeNCrj mice hair relative to ICA.
- In the synthesis of tetranuclear manganese carboxylate complexes possessing imidazole-based N/O chelating ligands.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | NI4001000 |
| HazardClass | IRRITANT |
| HS Code | 29332900 |
