PRODUCT Properties
| Melting point: | 161-162 °C (lit.) |
| Boiling point: | 345.3±25.0 °C(Predicted) |
| Density | 1.286±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 8.60±0.13(Predicted) |
| color | White to Light yellow to Dark green |
| BRN | 1906921 |
| InChI | InChI=1S/C7H7NO2/c8-7(10)5-1-3-6(9)4-2-5/h1-4,9H,(H2,8,10) |
| InChIKey | QXSAKPUBHTZHKW-UHFFFAOYSA-N |
| SMILES | C(N)(=O)C1=CC=C(O)C=C1 |
| CAS DataBase Reference | 619-57-8(CAS DataBase Reference) |
Description and Uses
4-Hydroxybenzamide was used in the synthesis of balanol, a potent protein kinase C (PKC) inhibitor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
