A4817612
3-Hydroxy-4-nitrobenzoic Acid , >96.0% , 619-14-7
CAS NO.：619-14-7
Empirical Formula: C7H5NO5
Molecular Weight: 183.12
MDL number: MFCD00007110
EINECS: 210-580-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB77.60 | In Stock |
|
| 100G | RMB228.80 | In Stock |
|
| 250G | RMB535.20 | In Stock |
|
| 500g | RMB1055.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 229-231 °C (lit.) |
| Boiling point: | 316.77°C (rough estimate) |
| Density | 1.6074 (rough estimate) |
| refractive index | 1.6280 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | 1.08g/l (calculated) |
| pka | 3.30±0.10(Predicted) |
| form | Powder |
| color | Yellow to brown |
| Water Solubility | insoluble |
| BRN | 2107564 |
| InChI | InChI=1S/C7H5NO5/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3,9H,(H,10,11) |
| InChIKey | XLDLRRGZWIEEHT-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C([N+]([O-])=O)C(O)=C1 |
Description and Uses
3-Hydroxy-4-nitrobenzoic acid is a compound that is capable of inhibiting chloroplast development in linseed and oat seedlings. 3-Hydroxy-4-nitrobenzoic acid also exhibits inhibitory effects on Ras proteins, making them potentially useful compounds in treating cancer.
