A4795012
Heneicosanoic Acid , 98% , 2363-71-5
CAS NO.：2363-71-5
Empirical Formula: C21H42O2
Molecular Weight: 326.56
MDL number: MFCD00002805
EINECS: 219-113-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB263.20 | In Stock |
|
| 1G | RMB663.20 | In Stock |
|
| 5G | RMB2079.20 | In Stock |
|
| 10g | RMB3335.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 74-75 °C(lit.) |
| Boiling point: | 170 °C (0.07501 mmHg) |
| Density | 0.8903 (rough estimate) |
| refractive index | 1.4538 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | almost transparency in hot Methanol |
| pka | 4.78±0.10(Predicted) |
| form | Shiny Fluffy Crystalline Powder |
| color | White |
| BRN | 1711889 |
| InChI | InChI=1S/C21H42O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23/h2-20H2,1H3,(H,22,23) |
| InChIKey | CKDDRHZIAZRDBW-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCCCCCCCCCCCCCCCCC |
| LogP | 9.810 (est) |
Description and Uses
Heneicosanoic Acid is a long chain fatty acid used by S.epidermidis for lipopeptide production. In addition, Heneicosanoic Acid can be used as an analytical standard.Environmental contaminants; food contaminants.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29159000 |
