A4758612
4-Hydroxy-3-methylbenzaldehyde , 97% , 15174-69-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB112.80 | In Stock |
|
| 5G | RMB430.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-120 °C (lit.) |
| Boiling point: | 250.6°C (estimate) |
| Density | 1.1150 (rough estimate) |
| refractive index | 1.5090 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly, Heated), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | 8.12±0.18(Predicted) |
| color | Off-white, tan to brown |
| InChI | InChI=1S/C8H8O2/c1-6-4-7(5-9)2-3-8(6)10/h2-5,10H,1H3 |
| InChIKey | BAKYASSDAXQKKY-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(O)C(C)=C1 |
| LogP | 1.807 (est) |
| CAS DataBase Reference | 15174-69-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Hydroxy-3-methylbenzaldehyde(15174-69-3) |
Description and Uses
4-Hydroxy-3-methylbenzaldehyde was used in the preparation of a new series of benzothiazole schiff bases which display antitumor activity against cervical cancer. Also used in the synthesis of novel pyrimidine derivatives which possess antibacterial properties against gram-positive and gram-negative bacteria.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | PG3 |
| WGK Germany | 3 |
| HS Code | 29124900 |
