A4571356
17α-Hydroxy-11-deoxycorticosterone-21-acetate , 97% , 640-87-9
CAS NO.：640-87-9
Empirical Formula: C23H32O5
Molecular Weight: 388.5
MDL number: MFCD00051137
EINECS: 211-369-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB239.20 | In Stock |
|
| 5g | RMB799.20 | In Stock |
|
| 25g | RMB2399.20 | In Stock |
|
| 100g | RMB6719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 233-235°C |
| Boiling point: | 537.9±50.0 °C(Predicted) |
| Density | 1.4 g/cm3 |
| storage temp. | Refrigerator |
| solubility | Chloroform (Sparingly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 12.59±0.60(Predicted) |
| color | White to Off-White |
| InChIKey | HPAKILCZTKWIFK-JZTHCNPZSA-N |
| SMILES | C1(=O)C=C2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)[C@@](O)(C(=O)COC(C)=O)CC3)CC2 |
Description and Uses
An acetate substance 'S' - a synthetic steroid as carbaryl synergist.
Safety
| Symbol(GHS) |   GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H411-H361 |
| Precautionary statements | P201-P202-P281-P308+P313-P405-P501 |
| HS Code | 2937.90.9000 |
