A4407612
3-Fluorophenylacetic Acid , >98.0%(GC)(T) , 331-25-9
CAS NO.：331-25-9
Empirical Formula: C8H7FO2
Molecular Weight: 154.14
MDL number: MFCD00004331
EINECS: 206-360-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB49.60 | In Stock |
|
| 100G | RMB188.00 | In Stock |
|
| 500g | RMB845.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42-44 °C (lit.) |
| Boiling point: | 151 °C |
| Density | 1.1850 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.10±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Slightly soluble in chloroform and methanol. Insoluble in water. |
| BRN | 775898 |
| InChI | InChI=1S/C8H7FO2/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | YEAUYVGUXSZCFI-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC(F)=C1 |
Description and Uses
3-Fluorophenylacetic acid has been used as building block to synthesize the pentaamine and bis-heterocyclic libraries.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280g-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 38-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| TSCA | T |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
