A4394512
5-Fluoroanthranilic Acid , >98.0%(HPLC) , 446-08-2
Synonym(s):
5-Fluoroanthranilic acid
CAS NO.：446-08-2
Empirical Formula: C7H6FNO2
Molecular Weight: 155.13
MDL number: MFCD00055566
EINECS: 207-159-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB71.20 | In Stock |
|
| 25G | RMB191.20 | In Stock |
|
| 100G | RMB719.20 | In Stock |
|
| 500g | RMB2879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181-183 °C(lit.) |
| Boiling point: | 223.67°C (rough estimate) |
| Density | 1.3021 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 1.86±0.10(Predicted) |
| form | Fine Crystalline Powder |
| color | Light yellow to light brown |
| BRN | 2803664 |
| InChI | InChI=1S/C7H6FNO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,9H2,(H,10,11) |
| InChIKey | FPQMGQZTBWIHDN-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(F)=CC=C1N |
Description and Uses
Used in the synthesis of styrylquinazolinones which are potential anticancer agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29224999 |
