A4378512
3-Fluoronitrobenzene , ≥97.0%(GC) , 402-67-5
CAS NO.：402-67-5
Empirical Formula: C6H4FNO2
Molecular Weight: 141.1
MDL number: MFCD00007196
EINECS: 206-953-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 10G | RMB44.00 | In Stock |
|
| 25G | RMB94.40 | In Stock |
|
| 100G | RMB337.60 | In Stock |
|
| 500G | RMB1678.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 1.7 °C (lit.) |
| Boiling point: | 205 °C (lit.) |
| Density | 1.325 g/mL at 25 °C (lit.) |
| RTECS | DA1385000 |
| refractive index | n |
| Flash point: | 170 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | clear liquid |
| color | green-yellow |
| Specific Gravity | 1.325 |
| Water Solubility | immiscible |
| BRN | 1862210 |
| InChI | InChI=1S/C6H4FNO2/c7-5-2-1-3-6(4-5)8(9)10/h1-4H |
| InChIKey | WMASLRCNNKMRFP-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC([N+]([O-])=O)=C1 |
Description and Uses
1-Fluoro-3-nitrobenzene was used as an internal standard in the regiospecific silver-mediated fluorination of aryl silanes.
Safety
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H373 |
| Precautionary statements | P260-P280-P301+P310-P302+P352+P312-P304+P340+P311-P314 |
| Hazard Codes | T,Xi,Xn |
| Risk Statements | 23/24/25-33-20/21/22 |
| Safety Statements | 36/37-45-36 |
| RIDADR | UN 2810 6.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049085 |
