A4364012
(3-Formyl-1-indolyl)acetic acid , ≥97.0% , 138423-98-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB94.40 | In Stock |
|
| 5G | RMB295.20 | In Stock |
|
| 25g | RMB1001.60 | In Stock |
|
| 100g | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 197-200 °C(lit.) |
| Boiling point: | 458.5±25.0 °C(Predicted) |
| Density | 1.30±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| pka | 4.15±0.10(Predicted) |
| Sensitive | Air Sensitive |
| BRN | 5431204 |
| InChI | InChI=1S/C11H9NO3/c13-7-8-5-12(6-11(14)15)10-4-2-1-3-9(8)10/h1-5,7H,6H2,(H,14,15) |
| InChIKey | ZUUGBTJTGRTIFK-UHFFFAOYSA-N |
| SMILES | N1(CC(O)=O)C2=C(C=CC=C2)C(C=O)=C1 |
Description and Uses
Handle to synthesize an indolecarboxaldehyde resin by coupling to an amino-resin. Amines and derivatives can be immobilized by reductive amination of this aldehyde resin. Mild cleavage with 50% TFA
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8-10-23 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
