A4356712
2-Fluoro-4-hydroxybenzaldehyde , 97% , 348-27-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB103.20 | In Stock |
|
| 25g | RMB387.20 | In Stock |
|
| 100g | RMB1462.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-170°C |
| Boiling point: | 254.2±20.0 °C(Predicted) |
| Density | 1.350±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | crystalline powder |
| pka | 6.78±0.18(Predicted) |
| color | Light tan |
| InChI | InChI=1S/C7H5FO2/c8-7-3-6(10)2-1-5(7)4-9/h1-4,10H |
| InChIKey | ONRPXRPUBXXCCM-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(O)C=C1F |
| CAS DataBase Reference | 348-27-6(CAS DataBase Reference) |
Description and Uses
2-Fluoro-4-hydroxybenzaldehyde is a useful reagent for preparation of 3,4-ring fused 7-azaindoles and deazapurines as potent JAK2 inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-37/38-41-52 |
| Safety Statements | 26-39 |
| Hazard Note | Irritant |
| HS Code | 2912490090 |
