A4336812
4-Fluoro-3-(trifluoromethyl)phenol , 98% , 61721-07-1
CAS NO.：61721-07-1
Empirical Formula: C7H4F4O
Molecular Weight: 180.1
MDL number: MFCD00043875
EINECS: 432-560-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.00 | In Stock |
|
| 5G | RMB80.00 | In Stock |
|
| 25G | RMB276.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 17 °C |
| Boiling point: | 84-86°C 15mm |
| Density | 1.145 |
| refractive index | 1.45 |
| Flash point: | 90°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to lump to clear liquid |
| pka | 8.97±0.18(Predicted) |
| color | White or Colorless to Orange to Green |
| BRN | 2098736 |
| InChI | InChI=1S/C7H4F4O/c8-6-2-1-4(12)3-5(6)7(9,10)11/h1-3,12H |
| InChIKey | DHPCRFYUUWAGAH-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(F)C(C(F)(F)F)=C1 |
Description and Uses
4-Fluoro-3-trifluoromethylphenol
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H227-H290-H302-H314-H317-H411-H318-H332-H401 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P501a-P210-P234-P260-P264-P270-P272-P273-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P391-P403+P235-P405-P406-P501 |
| Hazard Codes | T,Xn |
| Risk Statements | 22-34-36/37/38-20/21/22 |
| Safety Statements | 23-26-28-36/37/39-45 |
| RIDADR | 2922 |
| Hazard Note | Toxic |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29081990 |
