A4293512
2-Fluorophenylacetic acid , 96% , 451-82-1
CAS NO.：451-82-1
Empirical Formula: C8H7FO2
Molecular Weight: 154.14
MDL number: MFCD00004315
EINECS: 207-196-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB44.00 | In Stock |
|
| 100G | RMB182.40 | In Stock |
|
| 500G | RMB638.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-62 °C (lit.) |
| Boiling point: | 203.5°C (rough estimate) |
| Density | 1.1850 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Solid |
| pka | 4.01±0.10(Predicted) |
| color | Off-White |
| BRN | 775955 |
| InChI | InChI=1S/C8H7FO2/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | RPTRFSADOICSSK-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC=C1F |
| CAS DataBase Reference | 451-82-1(CAS DataBase Reference) |
| NIST Chemistry Reference | O-fluorophenylacetic acid(451-82-1) |
| EPA Substance Registry System | Benzeneacetic acid, 2-fluoro- (451-82-1) |
Description and Uses
2-Fluorophenylacetic acid was used:
- in the synthesis of thiazolino[3,2-c]pyrimidin-5,7-diones and N-[2-(3,4-dichlorophenyl)-ethyl]-N′-[2-(2-fluorophenyl)-ethyl]-ethane-1,2-diamine
- as chiral derivatizing agent for determination of enantiomeric composition of chiral, nonracemic compounds by 19F NMR spectroscopy
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P280g-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 38-36/37/38 |
| Safety Statements | 22-24/25-36/37/39-27-26 |
| WGK Germany | 3 |
| F | 13 |
| TSCA | T |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
