A4278712
Fmoc-α-Me-Ala-OH , 97% , 94744-50-0
Synonym(s):
Fmoc-α-aminoisobutyric acid;Fmoc-α-methylalanine;Fmoc-Aib-OH;N-α-Fmoc-α-aminoisobutyric acid, N-Fmoc-C-α-methylalanine
CAS NO.：94744-50-0
Empirical Formula: C19H19NO4
Molecular Weight: 325.36
MDL number: MFCD00151913
EINECS: 619-072-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB101.60 | In Stock |
|
| 100g | RMB379.20 | In Stock |
|
| 500g | RMB1690.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 182-188 °C |
| Boiling point: | 544.3±33.0 °C(Predicted) |
| Density | 1.256±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 3.98±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Sensitive | Moisture Sensitive |
| BRN | 5604328 |
| InChI | InChI=1S/C19H19NO4/c1-19(2,17(21)22)20-18(23)24-11-16-14-9-5-3-7-12(14)13-8-4-6-10-15(13)16/h3-10,16H,11H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | HOZZVEPRYYCBTO-UHFFFAOYSA-N |
| SMILES | C(O)(=O)[C@](C)(C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 94744-50-0(CAS DataBase Reference) |
Description and Uses
L-Fmoc-Aminobutyric Acid, is an alanine derivative used in chemical synthesis and peptide chemistry.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
