A4276512
Fmoc-Orn(Boc)-OH , 96% , 109425-55-0
Synonym(s):
Nα-Fmoc-Nδ-Boc-L -ornithine;Nδ-Boc-Nα-Fmoc-L -ornithine;Fmoc-Orn(Boc)-OH;N-α-Fmoc-N-δ-t.-Boc-L-ornithine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB75.20 | In Stock |
|
| 25G | RMB267.20 | In Stock |
|
| 100g | RMB940.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 111-115℃ |
| Boiling point: | 679.0±55.0 °C(Predicted) |
| Density | 1.226±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.85±0.21(Predicted) |
| color | White to Almost white |
| BRN | 4772025 |
| InChIKey | JOOIZTMAHNLNHE-NRFANRHFSA-N |
| SMILES | C(O)(=O)[C@H](CCCNC(OC(C)(C)C)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 109425-55-0(CAS DataBase Reference) |
Description and Uses
Fmoc-Orn(Boc)-OH is an ornithine-containing amino acid building block. It has been used to conjugate ornithine to GFP-labeled peptides, enhancing cell permeability when compared to unconjugated GFP-labeled peptides. This compound is useful in preparing cyclic peptides and special arginine derivates.
Fmoc-Orn(Boc)-OH is a biochemical reagent. It can be used as a biomaterial or organic compound in life science-related research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H302-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P-P264-P270-P301+P312-P330-P501 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
