A4084012
3-(2-Ethylhexyloxy)-1,2-propanediol , >98.0%(GC) , 70445-33-9
CAS NO.：70445-33-9
Empirical Formula: C11H24O3
Molecular Weight: 204.31
MDL number: MFCD03790878
EINECS: 408-080-2
| Pack Size | Price | Stock | Quantity |
| 5ml | RMB44.80 | In Stock |
|
| 25ML | RMB127.20 | In Stock |
|
| 100ml | RMB399.20 | In Stock |
|
| 500ml | RMB1439.20 | In Stock |
|
| 2.5L | RMB4319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 325°C |
| Density | 0.962 |
| refractive index | 1.4490 to 1.4530 |
| Flash point: | 152°C(lit.) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | 13.67±0.20(Predicted) |
| color | Colourless |
| Odor | Characteristic |
| InChI | InChI=1S/C11H24O3/c1-3-5-6-10(4-2)8-14-9-11(13)7-12/h10-13H,3-9H2,1-2H3 |
| InChIKey | NCZPCONIKBICGS-UHFFFAOYSA-N |
| SMILES | C(O)C(O)COCC(CC)CCCC |
| LogP | 2.470 (est) |
| CAS DataBase Reference | 70445-33-9 |
Description and Uses
Ethylhexylglycerin is the novel raw material for deodorants application and is widely used as a cosmetic emollient. Ethylhexylglycerin reliably inhibits the odor-causing bacteria, yeast and fungi on the skin.
