A4078812
Ethoxy(pentafluoro)cyclotriphosphazene , >98.0%(GC) , 33027-66-6
CAS NO.：33027-66-6
Empirical Formula: C2H5F5N3OP3
Molecular Weight: 275
MDL number: MFCD28386107
EINECS: 608-823-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.80 | In Stock |
|
| 5G | RMB66.40 | In Stock |
|
| 25g | RMB186.40 | In Stock |
|
| 100g | RMB543.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 42°C/30mmHg(lit.) |
| Density | 2.08±0.1 g/cm3(Predicted) |
| refractive index | 1.3610-1.3650 |
| storage temp. | 0-10°C |
| pka | -23.10±0.39(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C2H5F5N3OP3/c1-2-11-14(7)9-12(3,4)8-13(5,6)10-14/h2H2,1H3 |
| InChIKey | CBTAIOOTRCAMBD-UHFFFAOYSA-N |
| SMILES | O(P1(=NP(F)(F)=NP(F)(F)=N1)F)CC |
| EPA Substance Registry System | Ethoxy(pentafluoro)cyclotriphosphazene (33027-66-6) |
Description and Uses
Ethoxy(pentafluoro)cyclotriphosphazene is used as a high efficiency flame retardant in batteries.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501 |
| RIDADR | 1760 |
| HS Code | 2934.99.9001 |
| HazardClass | 8 |
| PackingGroup | III |
