PRODUCT Properties
| Boiling point: | 655.6±40.0 °C(Predicted) |
| Density | 1.162±0.06 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | DMSO : ≥ 29 mg/mL (64.50 mM) |
| pka | 3.58±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| InChIKey | GHCZAUBVMUEKKP-VHGKAQQHNA-N |
| SMILES | C(O)(=O)CNC(=O)CC[C@@H](C)[C@@H]1[C@]2(CCC3[C@]4(C)[C@]([H])(C[C@@H](O)C3C2CC1)C[C@H](O)CC4)C |&1:9,11,12,16,18,21,28,r| |
Description and Uses
Glycochenodeoxycholic acid (Chenodeoxycholylglycine) is a relatively toxic bile salt generated in the liver from chenodeoxycholic acid and glycine. Glycochenodeoxycholic acid inhibits Autophagosome formation and impairs lysosomal function by inhibiting lysosomal proteolysis and increasing lysosomal pH in human normal liver cells, leading to the Apoptosis of human hepatocyte cells. Glycochenodeoxycholic acid induces stemness and chemoresistance via activating STAT3 signaling pathway in hepatocellular carcinoma cells (HCC). Glycochenodeoxycholic acid is promising for research in the field of cholestasis desease, hepatocellular carcinoma and primary sclerosing cholangitis (PSC)[1][2][3][4].
Safety
| Symbol(GHS) |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P240-P241-P242-P243-P260-P264-P270-P271-P280-P301+P310-P321-P330-P303+P361+P353-P304+P340-P307+P311-P312-P361+P364-P370+P378-P403+P233-P403+P235-P405-P501 |
