A4042512
4-Ethoxy-3-nitropyridine , >98.0%(GC) , 1796-84-5
CAS NO.：1796-84-5
Empirical Formula: C7H8N2O3
Molecular Weight: 168.15
MDL number: MFCD00234959
EINECS: 605-864-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB78.40 | In Stock |
|
| 5G | RMB249.60 | In Stock |
|
| 25g | RMB736.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 47.0 to 51.0 °C |
| Boiling point: | 287.5±20.0 °C(Predicted) |
| Density | 1.245±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.50±0.18(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C7H8N2O3/c1-2-12-7-3-4-8-5-6(7)9(10)11/h3-5H,2H2,1H3 |
| InChIKey | ABOSMHRLVUWEMT-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(OCC)=C1[N+]([O-])=O |
| CAS DataBase Reference | 1796-84-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| HS Code | 2933399990 |
