A4012012
Ethamsylate , ≥98% , 2624-44-4
Synonym(s):
Cyclonamine
CAS NO.：2624-44-4
Empirical Formula: C10H17NO5S
Molecular Weight: 263.31
MDL number: MFCD00867499
EINECS: 220-090-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB52.00 | In Stock |
|
| 5G | RMB60.00 | In Stock |
|
| 25G | RMB118.40 | In Stock |
|
| 100G | RMB305.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125° |
| Density | 1.3441 (rough estimate) |
| refractive index | 1.5060 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Very soluble in water, freely soluble in methanol, soluble in anhydrous ethanol, practically insoluble in methylene chloride. |
| form | Solid |
| color | White to Pale Red |
| Merck | 14,3722 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C6H6O5S.C4H11N/c7-4-1-2-5(8)6(3-4)12(9,10)11;1-3-5-4-2/h1-3,7-8H,(H,9,10,11);5H,3-4H2,1-2H3 |
| InChIKey | HBGOLJKPSFNJSD-UHFFFAOYSA-N |
| SMILES | C1(S(=O)(=O)O)=CC(=CC=C1O)O.N(CC)CC |
| CAS DataBase Reference | 2624-44-4(CAS DataBase Reference) |
| EPA Substance Registry System | Ethamsylate (2624-44-4) |
Description and Uses
Hemostatic;prostaglandin synthesis inhibitor
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P313-P337+P313-P362-P403+P233-P405-P501 |
| RTECS | DB6145000 |
| HS Code | 2921.19.6190 |
| HazardClass | IRRITANT |
| Toxicity | LD50 i.v. in mice, rats: 800, 1350 mg/kg (Esteve) |
