A3847712
4,5-Difluorophthalic acid , 97% , 18959-31-4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB153.60 | In Stock |
|
| 1G | RMB287.20 | In Stock |
|
| 5g | RMB880.80 | In Stock |
|
| 25g | RMB1199.20 | In Stock |
|
| 10g | RMB1744.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 161.5-162 °C |
| Boiling point: | 378.7±42.0 °C(Predicted) |
| Density | 1.644±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.55±0.10(Predicted) |
| InChI | InChI=1S/C8H4F2O4/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h1-2H,(H,11,12)(H,13,14) |
| InChIKey | FFSBOABNRUJQFW-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=CC(F)=C(F)C=C1C(O)=O |
Description and Uses
4,5-difluorophthalic acid can be used to prepare a polyguanidine bactericidal compound miscible with anionic surfactants. 4,5-difluorophthalic acid is used to modify the PHMB molecule so that it has multiple carboxyl groups at the ends and has amphoteric surfactant properties.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P260-P280-P312 |
| HS Code | 2917399590 |
