A3715412
1-(diphenylmethyl)azetidine-3-carbonitrile , 97% , 36476-86-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5g | RMB55.20 | In Stock |
|
| 25G | RMB143.20 | In Stock |
|
| 100g | RMB447.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-153°C |
| Boiling point: | 384.3±42.0 °C(Predicted) |
| Density | 1.15±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 5.61±0.10(Predicted) |
| form | Solid |
| color | White |
| Stability: | Good |
| InChI | InChI=1S/C17H16N2/c18-11-14-12-19(13-14)17(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,14,17H,12-13H2 |
| InChIKey | IXMOEAHDRKNAAG-UHFFFAOYSA-N |
| SMILES | N1(C(C2=CC=CC=C2)C2=CC=CC=C2)CC(C#N)C1 |
| CAS DataBase Reference | 36476-86-5(CAS DataBase Reference) |
Description and Uses
A proline analog and proline formation inhibitor
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | C |
| Risk Statements | 20/21/22-36/37/38-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3276 |
| HazardClass | IRRITANT |
| HazardClass | 6.1 |
| HS Code | 29339900 |
