A3610412
1,2-Dodecanediol , >93.0%(GC) , 1119-87-5
CAS NO.：1119-87-5
Empirical Formula: C12H26O2
Molecular Weight: 202.33
MDL number: MFCD00004726
EINECS: 214-289-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB239.20 | In Stock |
|
| 100G | RMB687.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-60 °C (lit.) |
| Boiling point: | 280.32°C (rough estimate) |
| Density | 0.9216 (rough estimate) |
| refractive index | 1.4617 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystaline |
| pka | 14.46±0.20(Predicted) |
| color | White to Almost white |
| BRN | 1700179 |
| InChI | InChI=1S/C12H26O2/c1-2-3-4-5-6-7-8-9-10-12(14)11-13/h12-14H,2-11H2,1H3 |
| InChIKey | ZITKDVFRMRXIJQ-UHFFFAOYSA-N |
| SMILES | C(O)C(O)CCCCCCCCCC |
| LogP | 3.577 (est) |
Description and Uses
1,2-Dodecanediol was used in the preparation of:
- lipophilic diamines and amino alcohols
- Fe(II), Co(II) and Ni(II) ferrite nanoparticles in the range of 9-25 nm
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 1 |
| HS Code | 2905.39.9000 |
