A3519012
3,5-Di-<i>tert</i>-butylsalicylic Acid , >95.0% , 19715-19-6
CAS NO.：19715-19-6
Empirical Formula: C15H22O3
Molecular Weight: 250.33
MDL number: MFCD00059058
EINECS: 243-246-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB109.60 | In Stock |
|
| 100G | RMB319.20 | In Stock |
|
| 500G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 157-162 °C (lit.) |
| Boiling point: | 335.6±42.0 °C(Predicted) |
| Density | 1.070±0.06 g/cm3(Predicted) |
| Flash point: | 179 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | Powder |
| pka | 3.34±0.14(Predicted) |
| color | Off-white to beige |
| InChI | InChI=1S/C15H22O3/c1-14(2,3)9-7-10(13(17)18)12(16)11(8-9)15(4,5)6/h7-8,16H,1-6H3,(H,17,18) |
| InChIKey | ZWQBZEFLFSFEOS-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(C(C)(C)C)=CC(C(C)(C)C)=C1O |
| CAS DataBase Reference | 19715-19-6(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 3,5-bis(1,1-dimethylethyl)-2-hydroxy- (19715-19-6) |
Description and Uses
3,5-Di-tert-butylsalicylic acid was used to study long wavelength fluorescence emission of 3,5-Di-tert-butylsalicylic acid in a variety of organic solvents. It was also used to catalyze the reaction between aldehydes and silyl ketene acetals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29182900 |
