A3481712
3-Dimethylaminobenzoic Acid , >98.0% , 99-64-9
Synonym(s):
3-Dimethylaminobenzoic acid
CAS NO.：99-64-9
Empirical Formula: C9H11NO2
Molecular Weight: 165.19
MDL number: MFCD00002497
EINECS: 202-775-2
| Pack Size | Price | Stock | Quantity |
| 25G | RMB55.20 | In Stock |
|
| 100G | RMB155.20 | In Stock |
|
| 500G | RMB616.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-150 °C(lit.) |
| Boiling point: | 293.03°C (rough estimate) |
| Density | 1.1603 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | Practically insoluble[in water] |
| pka | 3.36±0.10(Predicted) |
| form | Crystalline Powder |
| color | Light yellow to yellow-beige |
| Water Solubility | Soluble in methanol (50 mg/ml). Insoluble in water. |
| BRN | 2208586 |
| InChI | InChI=1S/C9H11NO2/c1-10(2)8-5-3-4-7(6-8)9(11)12/h3-6H,1-2H3,(H,11,12) |
| InChIKey | NEGFNJRAUMCZMY-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(N(C)C)=C1 |
Description and Uses
3-(Dimethylamino)benzoic acid has been used to analyse glucose content from the extraction of starch and soluble sugars.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29224995 |
