A3478212
Dimethyl 2,2'-Bipyridine-4,4'-dicarboxylate , >98.0% , 71071-46-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB68.00 | In Stock |
|
| 1G | RMB151.20 | In Stock |
|
| 5G | RMB605.60 | In Stock |
|
| 25g | RMB1900.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 208.0 to 212.0 °C |
| Boiling point: | 440.8±45.0 °C(Predicted) |
| Density | 1.254±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 1.85±0.30(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C14H12N2O4/c1-19-13(17)9-3-5-15-11(7-9)12-8-10(4-6-16-12)14(18)20-2/h3-8H,1-2H3 |
| InChIKey | HBWBVIDKBKOVEX-UHFFFAOYSA-N |
| SMILES | C1(C2=NC=CC(C(OC)=O)=C2)=NC=CC(C(OC)=O)=C1 |
Description and Uses
4,4'-Bis(methoxycarbonyl)-2,2'-bipyridine is a chemical reaction reagent or organic synthesis intermediate that can be used as a ligand in cross-coupling reactions, binding to metal ions and forming complexes. 4,4'-Bis(methoxycarbonyl)-2,2'-bipyridine has a constant value that maximizes the yield of the reaction and has luminescence, which can be used for voltammetry studies. The transfer of the chromophore or the catalyst can be optimized using this product. 4,4'-Bis(methoxycarbonyl)-2,2'-bipyridine provides a method for cross-coupling reactions using electrochemical studies and dichroism.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HS Code | 29333990 |
