A3466312
3,6-Diphenylcarbazole , >99.0%(HPLC) , 56525-79-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB63.20 | In Stock |
|
| 5G | RMB231.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186℃ |
| Boiling point: | 575℃ |
| Density | 1.198 |
| Flash point: | 256℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 16.82±0.30(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C24H17N/c1-3-7-17(8-4-1)19-11-13-23-21(15-19)22-16-20(12-14-24(22)25-23)18-9-5-2-6-10-18/h1-16,25H |
| InChIKey | PCMKGEAHIZDRFL-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(C3=CC=CC=C3)C=C2)C2=C1C=CC(C1=CC=CC=C1)=C2 |
| CAS DataBase Reference | 56525-79-2 |
Description and Uses
3,6-Diphenyl-9H-carbazole, also known as 3,6-Diphenylcarbazole (DPhCz), is another electron-donating 9H-carbazole derivative that has an extended π-π conjugation from the carbazole fusion ring to the phenyl group attached to the 3,-6 position. The degree of electron donating strength is in the order of carbazole 3,6-dimethylcarbazole 3,6-diphenylcarbazole, resulting in the relatively red-shift of emissions of 3,6-dimethylcarbazole and 3,6-diphenylcarbazole while comparing non-substituted carbazoles.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| HS Code | 2933.99.8290 |
