A3407512
3',4'-Dihydroxyacetophenone , ≥98.0%(GC) , 1197-09-7
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB45.60 | In Stock |
|
| 1G | RMB97.60 | In Stock |
|
| 5G | RMB455.20 | In Stock |
|
| 25G | RMB863.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117 °C |
| Boiling point: | 127-133 °C(Press: 11 Torr) |
| Density | 1.291±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Soluble), Methanol (Slightly) |
| form | Solid |
| pka | 8.00±0.18(Predicted) |
| color | Off-White to Beige |
| InChI | InChI=1S/C8H8O3/c1-5(9)6-2-3-7(10)8(11)4-6/h2-4,10-11H,1H3 |
| InChIKey | UCQUAMAQHHEXGD-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(O)C(O)=C1)C |
| LogP | 1.056 (est) |
Description and Uses
3'',4''-Dihydroxyacetophenone is an active constituent of Chinese medicine and also has antimelanogenic actiivity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37 |
| RTECS | KM5775200 |
| HazardClass | IRRITANT |
| HS Code | 2914390090 |
