A3376412
2,5-Dihydroxyterephthalic Acid , ≥98.0%(HPLC) , 610-92-4
Synonym(s):
2,5-Dihydroxy-1,4-benzenedicarboxylic acid
CAS NO.：610-92-4
Empirical Formula: C8H6O6
Molecular Weight: 198.13
MDL number: MFCD00132933
EINECS: 210-239-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB54.40 | In Stock |
|
| 25G | RMB203.20 | In Stock |
|
| 100G | RMB735.20 | In Stock |
|
| 500g | RMB2560.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| Boiling point: | 498.9±45.0 °C(Predicted) |
| Density | 1.779±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in hot dimethylformamide. |
| pka | 2.17±0.10(Predicted) |
| form | Solid |
| color | Dark gray to green |
| InChI | InChI=1S/C8H6O6/c9-5-1-3(7(11)12)6(10)2-4(5)8(13)14/h1-2,9-10H,(H,11,12)(H,13,14) |
| InChIKey | OYFRNYNHAZOYNF-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=CC(O)=C(C(O)=O)C=C1O |
Description and Uses
Employed as an important intermediate for raw material and intermediate used in organic synthesis agrochemical, pharmaceutical and dyestuff field.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29181990 |
