A3369312
Centrophenoxine hydrochloride , 98% , 3685-84-5
CAS NO.：3685-84-5
Empirical Formula: C12H16ClNO3.ClH
Molecular Weight: 294.17
MDL number: MFCD00012533
EINECS: 222-975-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB90.40 | In Stock |
|
| 5G | RMB222.40 | In Stock |
|
| 25G | RMB360.80 | In Stock |
|
| 100G | RMB987.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 133-135°C |
| Density | 1.3255 (rough estimate) |
| refractive index | 1.6140 (estimate) |
| storage temp. | −20°C |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Merck | 14,5780 |
| InChI | InChI=1S/C12H16ClNO3.ClH/c1-14(2)7-8-16-12(15)9-17-11-5-3-10(13)4-6-11;/h3-6H,7-9H2,1-2H3;1H |
| InChIKey | FIVHOHCAXWQPGC-UHFFFAOYSA-N |
| SMILES | C(OCCN(C)C)(=O)COC1=CC=C(Cl)C=C1.[H]Cl |
Description and Uses
Meclofenoxate hydrochloride is a cholinergic nootropic used as a dietary supplement and drug in the treatment of symptoms of senile dementia and Alzheimer's disease.
Cerebral stimulant;Acetylcholine precursor
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312a-P330-P501a |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| RTECS | AG0440000 |
| Toxicity | LD50 in mice (mg/kg): 330 i.v.; 1750 orally; 845 i.p. (Rumpf, Thuillier) |
