A3362412
1,3-Dibromo-2-chloro-5-fluorobenzene , 98% , 179897-90-6
CAS NO.：179897-90-6
Empirical Formula: C6H2Br2ClF
Molecular Weight: 288.34
MDL number: MFCD00061122
EINECS: 605-874-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB135.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-87 °C |
| Boiling point: | 260℃ |
| Density | 2.089 |
| refractive index | 1.6020 (estimate) |
| Flash point: | 111℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | crystalline solid |
| color | Off white to faint yellow |
| InChI | InChI=1S/C6H2Br2ClF/c7-4-1-3(10)2-5(8)6(4)9/h1-2H |
| InChIKey | PZKDJJMHRYNBOR-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(F)=CC(Br)=C1Cl |
Description and Uses
1,3-Dibromo-2-chloro-5-fluorobenzene is an important organic reagent that can be used as a building block for the synthesis of many organic compounds, such as 3-bromo-5-fluoro-11-methyl-11-azatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene and 6-(3'-bromo-2,2'-dichloro-5'-fluoro-[l,r-biphenyl]-3-yl)-2-methoxynicotinaldehyde.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| Hazard Note | Irritant |
| HS Code | 2903998090 |
