A3282512
3,5-Difluorophenol , 98% , 2713-34-0
CAS NO.：2713-34-0
Empirical Formula: C6H4F2O
Molecular Weight: 130.09
MDL number: MFCD00002255
EINECS: 608-047-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB188.00 | In Stock |
|
| 100G | RMB833.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54-57 °C (lit.) |
| Boiling point: | 65-68°C 1mm |
| Density | 1.2483 (estimate) |
| Flash point: | 159 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | ethanol: soluble50, clear, colorless to faint yellow or tan (mg/mL) |
| form | Crystals |
| pka | 7.97±0.10(Predicted) |
| color | White to beige |
| BRN | 2078616 |
| InChI | InChI=1S/C6H4F2O/c7-4-1-5(8)3-6(9)2-4/h1-3,9H |
| InChIKey | HJSSBIMVTMYKPD-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(F)=CC(F)=C1 |
Description and Uses
3,5-Difluorophenol is an important medicine, pesticide, and liquid crystal material intermediate, mainly used in the synthesis of liquid crystal materials and antifungal agents, and also used in the synthesis of dyes, plastics and rubber additives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi,C,F |
| Risk Statements | 20/21/22-36/37/38-34-11 |
| Safety Statements | 26-36-45-36/37/39-16 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29081000 |
